C25H33ClO7 — CID 58264777
[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 4-(2-chloroacetyl)oxyadamantane-1-carboxylate (PubChem CID 58264777) has the molecular formula C25H33ClO7 and a molecular weight of 480.99 g/mol. Its IUPAC name is [2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 4-(2-chloroacetyl)oxyadamantane-1-carboxylate.
| Compound Name | [2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 4-(2-chloroacetyl)oxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 58264777 |
| Molecular Formula | C25H33ClO7 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 4-(2-chloroacetyl)oxyadamantane-1-carboxylate |
| SMILES | O=C(CCl)OC1C2CC3CC1CC(C(=O)OCC(=O)OC14CC5CC(CC(O)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C25H33ClO7/c26-11-19(27)32-21-17-2-14-3-18(21)10-23(4-14,9-17)22(29)31-12-20(28)33-25-7-15-1-16(8-25)6-24(30,5-15)13-25/h14-18,21,30H,1-13H2 |
| InChIKey | DNUOXGFSPYGBIV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|