C16H20O9 — CID 58445669
(2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2,2-dimethylbutanoate (PubChem CID 58445669) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is (2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2,2-dimethylbutanoate.
| Compound Name | (2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58445669 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2',10-dioxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-oxolane]-9-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C3OC4(COC(=O)C4)OC3OC12 |
| InChI | InChI=1S/C16H20O9/c1-4-15(2,3)14(19)23-10-8-9(21-12(10)18)11-13(22-8)25-16(24-11)5-7(17)20-6-16/h8-11,13H,4-6H2,1-3H3 |
| InChIKey | GJNIOVRKKPEPRN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|