C28H30F12O11 — CID 90779100
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-(2-ethyl-2,3,3-trimethylbutanoyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclopentane]-1',2'-dicarboxylate (PubChem CID 90779100) has the molecular formula C28H30F12O11 and a molecular weight of 770.51 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-(2-ethyl-2,3,3-trimethylbutanoyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclopentane]-1',2'-dicarboxylate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-(2-ethyl-2,3,3-trimethylbutanoyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclopentane]-1',2'-dicarboxylate |
|---|---|
| PubChem CID | 90779100 |
| Molecular Formula | C28H30F12O11 |
| Molecular Weight | 770.51 g/mol |
| Exact Mass | 770.16 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 9-(2-ethyl-2,3,3-trimethylbutanoyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclopentane]-1',2'-dicarboxylate |
| SMILES | CCC(C)(C(=O)OC1C(=O)OC2C3OC4(CC(C(=O)OC(C(F)(F)F)C(F)(F)F)C(C(=O)OC(C(F)(F)F)C(F)(F)F)C4)OC3OC12)C(C)(C)C |
| InChI | InChI=1S/C28H30F12O11/c1-6-23(5,22(2,3)4)21(44)47-13-11-12(45-17(13)43)14-18(46-11)51-24(50-14)7-9(15(41)48-19(25(29,30)31)26(32,33)34)10(8-24)16(42)49-20(27(35,36)37)28(38,39)40/h9-14,18-20H,6-8H2,1-5H3 |
| InChIKey | NLXOWKVRVILFAN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|