C25H26F6O9 — CID 163763520
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-methyl-10-oxo-9-(2,2,3-trimethylbutanoyloxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]benzoate (PubChem CID 163763520) has the molecular formula C25H26F6O9 and a molecular weight of 584.46 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-methyl-10-oxo-9-(2,2,3-trimethylbutanoyloxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]benzoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-methyl-10-oxo-9-(2,2,3-trimethylbutanoyloxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]benzoate |
|---|---|
| PubChem CID | 163763520 |
| Molecular Formula | C25H26F6O9 |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-methyl-10-oxo-9-(2,2,3-trimethylbutanoyloxy)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl]benzoate |
| SMILES | CC(C)C(C)(C)C(=O)OC1C(=O)OC2C3OC(C)(c4ccc(C(=O)OC(C(F)(F)F)C(F)(F)F)cc4)OC3OC12 |
| InChI | InChI=1S/C25H26F6O9/c1-10(2)22(3,4)21(34)37-15-13-14(35-18(15)33)16-19(36-13)40-23(5,39-16)12-8-6-11(7-9-12)17(32)38-20(24(26,27)28)25(29,30)31/h6-10,13-16,19-20H,1-5H3 |
| InChIKey | MAGMKRLAMXOEIJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|