C29H42F2O9Si — CID 58226025
(1,1-difluoro-3-trimethylsilylpropyl) 9-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate (PubChem CID 58226025) has the molecular formula C29H42F2O9Si and a molecular weight of 600.73 g/mol. Its IUPAC name is (1,1-difluoro-3-trimethylsilylpropyl) 9-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate.
| Compound Name | (1,1-difluoro-3-trimethylsilylpropyl) 9-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 58226025 |
| Molecular Formula | C29H42F2O9Si |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (1,1-difluoro-3-trimethylsilylpropyl) 9-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-carboxylate |
| SMILES | CC1C2CC(C(=O)OC3C(=O)OC4C5OC6(CCC(C(=O)OC(F)(F)CC[Si](C)(C)C)CC6)OC5OC34)C(C2)C1C |
| InChI | InChI=1S/C29H42F2O9Si/c1-14-15(2)18-12-17(14)13-19(18)25(33)36-22-20-21(35-26(22)34)23-27(37-20)40-28(38-23)8-6-16(7-9-28)24(32)39-29(30,31)10-11-41(3,4)5/h14-23,27H,6-13H2,1-5H3 |
| InChIKey | SFRGSRTZLAHLKE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|