C31H35O11S- — CID 140705893
4-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-3,5-di(propan-2-yl)benzenesulfonate (PubChem CID 140705893) has the molecular formula C31H35O11S- and a molecular weight of 615.68 g/mol. Its IUPAC name is 4-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-3,5-di(propan-2-yl)benzenesulfonate.
| Compound Name | 4-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-3,5-di(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 140705893 |
| Molecular Formula | C31H35O11S- |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 4-[5-oxo-2-(4-oxoadamantane-1-carbonyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-3,5-di(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(S(=O)(=O)[O-])cc(C(C)C)c1OC(=O)C1C2OC3C(OC(=O)C31)C2OC(=O)C12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C31H36O11S/c1-12(2)18-7-17(43(36,37)38)8-19(13(3)4)23(18)40-28(33)21-20-24-26(41-29(20)34)27(25(21)39-24)42-30(35)31-9-14-5-15(10-31)22(32)16(6-14)11-31/h7-8,12-16,20-21,24-27H,5-6,9-11H2,1-4H3,(H,36,37,38)/p-1 |
| InChIKey | MVVDRIWFXXTUKS-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 162.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|