C28H35O4S+ — CID 154598401
[8-(4-tert-butylphenyl)-5-oxo-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate (PubChem CID 154598401) has the molecular formula C28H35O4S+ and a molecular weight of 467.65 g/mol. Its IUPAC name is [8-(4-tert-butylphenyl)-5-oxo-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate.
| Compound Name | [8-(4-tert-butylphenyl)-5-oxo-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 154598401 |
| Molecular Formula | C28H35O4S+ |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | [8-(4-tert-butylphenyl)-5-oxo-4-oxa-8-thioniatricyclo[4.2.1.03,7]nonan-2-yl] adamantane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc([S+]2C3CC4C(=O)OC(C3OC(=O)C35CC6CC(CC(C6)C3)C5)C42)cc1 |
| InChI | InChI=1S/C28H35O4S/c1-27(2,3)18-4-6-19(7-5-18)33-21-11-20-24(33)23(31-25(20)29)22(21)32-26(30)28-12-15-8-16(13-28)10-17(9-15)14-28/h4-7,15-17,20-24H,8-14H2,1-3H3/q+1 |
| InChIKey | FMWKADZCUGCONB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|