C19H24N2O4 — CID 59815466
[5-cyano-6-isocyano-3-(2-oxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate (PubChem CID 59815466) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [5-cyano-6-isocyano-3-(2-oxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate.
| Compound Name | [5-cyano-6-isocyano-3-(2-oxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59815466 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [5-cyano-6-isocyano-3-(2-oxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl] 2,2-dimethylbutanoate |
| SMILES | [C-]#[N+]C1C(C#N)C2CC1C(OC(=O)C(C)(C)CC)C2C1CCOC1=O |
| InChI | InChI=1S/C19H24N2O4/c1-5-19(2,3)18(23)25-16-12-8-11(13(9-20)15(12)21-4)14(16)10-6-7-24-17(10)22/h10-16H,5-8H2,1-3H3 |
| InChIKey | CVNKFJJBOMRRTR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|