C21H31NO4 — CID 177413374
dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate (PubChem CID 177413374) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate.
| Compound Name | dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 177413374 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate |
| SMILES | C=C(CC(C)(CC(C)(C)C(=O)OC)C(=O)OC)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H31NO4/c1-15(16-9-11-17(12-10-16)22(5)6)13-21(4,19(24)26-8)14-20(2,3)18(23)25-7/h9-12H,1,13-14H2,2-8H3 |
| InChIKey | CWJMPYDCVRXXIK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|