About dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate
dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate (PubChem CID 177413374) has the molecular formula C21H31NO4
and a molecular weight of 361.48 g/mol. Its IUPAC name is dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate |
| PubChem CID | 177413374 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate |
| SMILES | C=C(CC(C)(CC(C)(C)C(=O)OC)C(=O)OC)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H31NO4/c1-15(16-9-11-17(12-10-16)22(5)6)13-21(4,19(24)26-8)14-20(2,3)18(23)25-7/h9-12H,1,13-14H2,2-8H3 |
| InChIKey | CWJMPYDCVRXXIK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate?
The IUPAC name of dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate (CID 177413374) is dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate.
What is the SMILES notation for dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate?
The canonical SMILES for dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate is C=C(CC(C)(CC(C)(C)C(=O)OC)C(=O)OC)c1ccc(N(C)C)cc1.
What is the InChIKey of dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate?
The InChIKey is CWJMPYDCVRXXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31NO4/c1-15(16-9-11-17(12-10-16)22(5)6)13-21(4,19(24)26-8)14-20(2,3)18(23)25-7/h9-12H,1,13-14H2,2-8H3.
What are the key properties of dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate?
dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate has a molecular weight of 361.48 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[2-[4-(dimethylamino)phenyl]prop-2-enyl]-2,4,4-trimethylpentanedioate is sourced from PubChem (CID 177413374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).