About 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate
2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate (PubChem CID 20813215) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate.
Analyze 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate?
The IUPAC name of 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate (CID 20813215) is 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate.
What is the SMILES notation for 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate?
The canonical SMILES for 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC(C)(C)c1ccc(N(C)C)cc1.
What is the InChIKey of 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate?
The InChIKey is WNIAKTQDCDLULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-8-16(2,3)15(19)20-17(4,5)13-9-11-14(12-10-13)18(6)7/h9-12H,8H2,1-7H3.
What are the key properties of 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate?
2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate has a molecular weight of 277.41 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenyl]propan-2-yl 2,2-dimethylbutanoate is sourced from PubChem (CID 20813215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).