C14H22N2O3 — CID 84754729
3-[N-ethyl-2-methoxy-4-(methylaminomethyl)anilino]propanoic acid (PubChem CID 84754729) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[N-ethyl-2-methoxy-4-(methylaminomethyl)anilino]propanoic acid.
| Compound Name | 3-[N-ethyl-2-methoxy-4-(methylaminomethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 84754729 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-[N-ethyl-2-methoxy-4-(methylaminomethyl)anilino]propanoic acid |
| SMILES | CCN(CCC(=O)O)c1ccc(CNC)cc1OC |
| InChI | InChI=1S/C14H22N2O3/c1-4-16(8-7-14(17)18)12-6-5-11(10-15-2)9-13(12)19-3/h5-6,9,15H,4,7-8,10H2,1-3H3,(H,17,18) |
| InChIKey | XGONFGPXMHUUSU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|