C17H28N2O3 — CID 84754298
3-[[4-[butyl(ethyl)amino]-3-methoxyphenyl]methylamino]propanoic acid (PubChem CID 84754298) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-[[4-[butyl(ethyl)amino]-3-methoxyphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[butyl(ethyl)amino]-3-methoxyphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 84754298 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3-[[4-[butyl(ethyl)amino]-3-methoxyphenyl]methylamino]propanoic acid |
| SMILES | CCCCN(CC)c1ccc(CNCCC(=O)O)cc1OC |
| InChI | InChI=1S/C17H28N2O3/c1-4-6-11-19(5-2)15-8-7-14(12-16(15)22-3)13-18-10-9-17(20)21/h7-8,12,18H,4-6,9-11,13H2,1-3H3,(H,20,21) |
| InChIKey | VCUWPSHSHFBJRJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|