C18H33N3O — CID 84754259
N-[[4-(dipropylamino)-3-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 84754259) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is N-[[4-(dipropylamino)-3-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[4-(dipropylamino)-3-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 84754259 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | N-[[4-(dipropylamino)-3-methoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CCCN(CCC)c1ccc(CNCCN(C)C)cc1OC |
| InChI | InChI=1S/C18H33N3O/c1-6-11-21(12-7-2)17-9-8-16(14-18(17)22-5)15-19-10-13-20(3)4/h8-9,14,19H,6-7,10-13,15H2,1-5H3 |
| InChIKey | BFXZYCHGSVHHRR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|