C16H26N2O4 — CID 84750410
2-[[4-[ethyl(2-hydroxyethyl)amino]-3-propan-2-yloxyphenyl]methylamino]acetic acid (PubChem CID 84750410) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[[4-[ethyl(2-hydroxyethyl)amino]-3-propan-2-yloxyphenyl]methylamino]acetic acid.
| Compound Name | 2-[[4-[ethyl(2-hydroxyethyl)amino]-3-propan-2-yloxyphenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 84750410 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[[4-[ethyl(2-hydroxyethyl)amino]-3-propan-2-yloxyphenyl]methylamino]acetic acid |
| SMILES | CCN(CCO)c1ccc(CNCC(=O)O)cc1OC(C)C |
| InChI | InChI=1S/C16H26N2O4/c1-4-18(7-8-19)14-6-5-13(10-17-11-16(20)21)9-15(14)22-12(2)3/h5-6,9,12,17,19H,4,7-8,10-11H2,1-3H3,(H,20,21) |
| InChIKey | OJUYJIYNFPBTES-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|