C15H11N5O6 — CID 71393748
quinolin-5-amine;1,3,5-trinitrobenzene (PubChem CID 71393748) has the molecular formula C15H11N5O6 and a molecular weight of 357.28 g/mol. Its IUPAC name is quinolin-5-amine;1,3,5-trinitrobenzene.
| Compound Name | quinolin-5-amine;1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 71393748 |
| Molecular Formula | C15H11N5O6 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | quinolin-5-amine;1,3,5-trinitrobenzene |
| SMILES | Nc1cccc2ncccc12.O=[N+]([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8N2.C6H3N3O6/c10-8-4-1-5-9-7(8)3-2-6-11-9;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-6H,10H2;1-3H |
| InChIKey | JNJLKBJUVSVUFZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|