C25H34N2O2SSn — CID 67417028
tributyl-[2-(4-nitrophenyl)-1,3-benzothiazol-6-yl]stannane (PubChem CID 67417028) has the molecular formula C25H34N2O2SSn and a molecular weight of 545.34 g/mol. Its IUPAC name is tributyl-[2-(4-nitrophenyl)-1,3-benzothiazol-6-yl]stannane.
| Compound Name | tributyl-[2-(4-nitrophenyl)-1,3-benzothiazol-6-yl]stannane |
|---|---|
| PubChem CID | 67417028 |
| Molecular Formula | C25H34N2O2SSn |
| Molecular Weight | 545.34 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | tributyl-[2-(4-nitrophenyl)-1,3-benzothiazol-6-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2nc(-c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C13H7N2O2S.3C4H9.Sn/c16-15(17)10-7-5-9(6-8-10)13-14-11-3-1-2-4-12(11)18-13;3*1-3-4-2;/h1,3-8H;3*1,3-4H2,2H3; |
| InChIKey | XYEHHSWGHJNORE-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.34 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|