C34H36N6O2S2 — CID 161454229
2-[4-(butylamino)phenyl]-1,3-benzothiazol-6-amine;N-butyl-4-(6-nitro-1,3-benzothiazol-2-yl)aniline (PubChem CID 161454229) has the molecular formula C34H36N6O2S2 and a molecular weight of 624.84 g/mol. Its IUPAC name is 2-[4-(butylamino)phenyl]-1,3-benzothiazol-6-amine;N-butyl-4-(6-nitro-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 2-[4-(butylamino)phenyl]-1,3-benzothiazol-6-amine;N-butyl-4-(6-nitro-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 161454229 |
| Molecular Formula | C34H36N6O2S2 |
| Molecular Weight | 624.84 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 2-[4-(butylamino)phenyl]-1,3-benzothiazol-6-amine;N-butyl-4-(6-nitro-1,3-benzothiazol-2-yl)aniline |
| SMILES | CCCCNc1ccc(-c2nc3ccc(N)cc3s2)cc1.CCCCNc1ccc(-c2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C17H17N3O2S.C17H19N3S/c1-2-3-10-18-13-6-4-12(5-7-13)17-19-15-9-8-14(20(21)22)11-16(15)23-17;1-2-3-10-19-14-7-4-12(5-8-14)17-20-15-9-6-13(18)11-16(15)21-17/h4-9,11,18H,2-3,10H2,1H3;4-9,11,19H,2-3,10,18H2,1H3 |
| InChIKey | WAYANVDDIDADKU-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.84 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|