C32H30BClN6O6S2 — CID 160780757
2-chloro-6-nitro-1,3-benzothiazole;4-(6-nitro-1,3-benzothiazol-2-yl)aniline;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 160780757) has the molecular formula C32H30BClN6O6S2 and a molecular weight of 705.03 g/mol. Its IUPAC name is 2-chloro-6-nitro-1,3-benzothiazole;4-(6-nitro-1,3-benzothiazol-2-yl)aniline;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 2-chloro-6-nitro-1,3-benzothiazole;4-(6-nitro-1,3-benzothiazol-2-yl)aniline;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 160780757 |
| Molecular Formula | C32H30BClN6O6S2 |
| Molecular Weight | 705.03 g/mol |
| Exact Mass | 704.14 |
| IUPAC Name | 2-chloro-6-nitro-1,3-benzothiazole;4-(6-nitro-1,3-benzothiazol-2-yl)aniline;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2ccc(N)cc2)OC1(C)C.Nc1ccc(-c2nc3ccc([N+](=O)[O-])cc3s2)cc1.O=[N+]([O-])c1ccc2nc(Cl)sc2c1 |
| InChI | InChI=1S/C13H9N3O2S.C12H18BNO2.C7H3ClN2O2S/c14-9-3-1-8(2-4-9)13-15-11-6-5-10(16(17)18)7-12(11)19-13;1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9;8-7-9-5-2-1-4(10(11)12)3-6(5)13-7/h1-7H,14H2;5-8H,14H2,1-4H3;1-3H |
| InChIKey | SANSJRLMYQQPFE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 182.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.03 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|