C19H23N3S — CID 59230776
N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pentane-1,5-diamine (PubChem CID 59230776) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pentane-1,5-diamine.
| Compound Name | N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 59230776 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pentane-1,5-diamine |
| SMILES | Cc1ccc2nc(-c3ccc(NCCCCCN)cc3)sc2c1 |
| InChI | InChI=1S/C19H23N3S/c1-14-5-10-17-18(13-14)23-19(22-17)15-6-8-16(9-7-15)21-12-4-2-3-11-20/h5-10,13,21H,2-4,11-12,20H2,1H3 |
| InChIKey | JIXDUQNNAWJCHZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|