C26H38N2OS — CID 143398417
but-1-ene;2,2-dimethyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]butan-1-ol;ethane (PubChem CID 143398417) has the molecular formula C26H38N2OS and a molecular weight of 426.67 g/mol. Its IUPAC name is but-1-ene;2,2-dimethyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]butan-1-ol;ethane.
| Compound Name | but-1-ene;2,2-dimethyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]butan-1-ol;ethane |
|---|---|
| PubChem CID | 143398417 |
| Molecular Formula | C26H38N2OS |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | but-1-ene;2,2-dimethyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]butan-1-ol;ethane |
| SMILES | C=CCC.CC.Cc1ccc2nc(-c3ccc(NCCC(C)(C)CO)cc3)sc2c1 |
| InChI | InChI=1S/C20H24N2OS.C4H8.C2H6/c1-14-4-9-17-18(12-14)24-19(22-17)15-5-7-16(8-6-15)21-11-10-20(2,3)13-23;1-3-4-2;1-2/h4-9,12,21,23H,10-11,13H2,1-3H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | QWPGFKCWRWBWIK-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|