C22H12FN5O4S — CID 118085020
2-[4-[5-(3,4-dinitrophenyl)imidazol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole (PubChem CID 118085020) has the molecular formula C22H12FN5O4S and a molecular weight of 461.43 g/mol. Its IUPAC name is 2-[4-[5-(3,4-dinitrophenyl)imidazol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole.
| Compound Name | 2-[4-[5-(3,4-dinitrophenyl)imidazol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole |
|---|---|
| PubChem CID | 118085020 |
| Molecular Formula | C22H12FN5O4S |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-[4-[5-(3,4-dinitrophenyl)imidazol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cncn2-c2ccc(-c3nc4ccc(F)cc4s3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H12FN5O4S/c23-15-4-7-17-21(10-15)33-22(25-17)13-1-5-16(6-2-13)26-12-24-11-20(26)14-3-8-18(27(29)30)19(9-14)28(31)32/h1-12H |
| InChIKey | IEIPUURPCCDEHU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|