C24H16ClFN2S — CID 155811236
2-[4-[2-(4-chlorophenyl)-5-methylpyrrol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole (PubChem CID 155811236) has the molecular formula C24H16ClFN2S and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenyl)-5-methylpyrrol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole.
| Compound Name | 2-[4-[2-(4-chlorophenyl)-5-methylpyrrol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole |
|---|---|
| PubChem CID | 155811236 |
| Molecular Formula | C24H16ClFN2S |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[4-[2-(4-chlorophenyl)-5-methylpyrrol-1-yl]phenyl]-6-fluoro-1,3-benzothiazole |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)n1-c1ccc(-c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C24H16ClFN2S/c1-15-2-13-22(16-3-7-18(25)8-4-16)28(15)20-10-5-17(6-11-20)24-27-21-12-9-19(26)14-23(21)29-24/h2-14H,1H3 |
| InChIKey | WFPZAGGKEPIJJY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|