C13H7FINOS — CID 114103523
5-(6-fluoro-1,3-benzothiazol-2-yl)-2-iodophenol (PubChem CID 114103523) has the molecular formula C13H7FINOS and a molecular weight of 371.17 g/mol. Its IUPAC name is 5-(6-fluoro-1,3-benzothiazol-2-yl)-2-iodophenol.
| Compound Name | 5-(6-fluoro-1,3-benzothiazol-2-yl)-2-iodophenol |
|---|---|
| PubChem CID | 114103523 |
| Molecular Formula | C13H7FINOS |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 5-(6-fluoro-1,3-benzothiazol-2-yl)-2-iodophenol |
| SMILES | Oc1cc(-c2nc3ccc(F)cc3s2)ccc1I |
| InChI | InChI=1S/C13H7FINOS/c14-8-2-4-10-12(6-8)18-13(16-10)7-1-3-9(15)11(17)5-7/h1-6,17H |
| InChIKey | ZQVTZVDKPJVHBK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|