C15H10N4OS — CID 59683107
6-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)pyrimidin-4-amine (PubChem CID 59683107) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 59683107 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-2-(furan-2-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(-c2nc3ccccc3s2)nc(-c2ccco2)n1 |
| InChI | InChI=1S/C15H10N4OS/c16-13-8-10(17-14(19-13)11-5-3-7-20-11)15-18-9-4-1-2-6-12(9)21-15/h1-8H,(H2,16,17,19) |
| InChIKey | VXAUDFRDCFXSPE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |