C9H5N3OS — CID 68714459
4-(1,3-benzothiazol-2-yl)oxadiazole (PubChem CID 68714459) has the molecular formula C9H5N3OS and a molecular weight of 203.23 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)oxadiazole.
| Compound Name | 4-(1,3-benzothiazol-2-yl)oxadiazole |
|---|---|
| PubChem CID | 68714459 |
| Molecular Formula | C9H5N3OS |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)oxadiazole |
| SMILES | c1ccc2sc(-c3conn3)nc2c1 |
| InChI | InChI=1S/C9H5N3OS/c1-2-4-8-6(3-1)10-9(14-8)7-5-13-12-11-7/h1-5H |
| InChIKey | DKWBVWZYAWBSEW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |