C12H10N2S2 — CID 24711318
5-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-amine (PubChem CID 24711318) has the molecular formula C12H10N2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-amine.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-amine |
|---|---|
| PubChem CID | 24711318 |
| Molecular Formula | C12H10N2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-amine |
| SMILES | Cc1cc(N)sc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H10N2S2/c1-7-6-10(13)16-11(7)12-14-8-4-2-3-5-9(8)15-12/h2-6H,13H2,1H3 |
| InChIKey | ULKUJLUUHZEIGI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |