C18H17NOS — CID 13051686
2-(2,2-dimethyl-3,4-dihydrochromen-8-yl)-1,3-benzothiazole (PubChem CID 13051686) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,4-dihydrochromen-8-yl)-1,3-benzothiazole.
| Compound Name | 2-(2,2-dimethyl-3,4-dihydrochromen-8-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 13051686 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(2,2-dimethyl-3,4-dihydrochromen-8-yl)-1,3-benzothiazole |
| SMILES | CC1(C)CCc2cccc(-c3nc4ccccc4s3)c2O1 |
| InChI | InChI=1S/C18H17NOS/c1-18(2)11-10-12-6-5-7-13(16(12)20-18)17-19-14-8-3-4-9-15(14)21-17/h3-9H,10-11H2,1-2H3 |
| InChIKey | JADIZDGHTQLBQU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |