About 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole
2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole (PubChem CID 143761672) has the molecular formula C12H10N2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole |
| PubChem CID | 143761672 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole |
| SMILES | C1=CC(c2nc3ccccc3s2)=CNC1 |
| InChI | InChI=1S/C12H10N2S/c1-2-6-11-10(5-1)14-12(15-11)9-4-3-7-13-8-9/h1-6,8,13H,7H2 |
| InChIKey | VFYFIUUDCJTKJA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole?
The IUPAC name of 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole (CID 143761672) is 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole.
What is the SMILES notation for 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole?
The canonical SMILES for 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole is C1=CC(c2nc3ccccc3s2)=CNC1.
What is the InChIKey of 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole?
The InChIKey is VFYFIUUDCJTKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2S/c1-2-6-11-10(5-1)14-12(15-11)9-4-3-7-13-8-9/h1-6,8,13H,7H2.
What are the key properties of 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole?
2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole has a molecular weight of 214.29 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydropyridin-5-yl)-1,3-benzothiazole is sourced from PubChem (CID 143761672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).