C16H16N6O — CID 22267831
N-(diaminomethylidene)-5-ethyl-1-quinolin-5-ylpyrazole-4-carboxamide (PubChem CID 22267831) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-ethyl-1-quinolin-5-ylpyrazole-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-5-ethyl-1-quinolin-5-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 22267831 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-(diaminomethylidene)-5-ethyl-1-quinolin-5-ylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)N=C(N)N)cnn1-c1cccc2ncccc12 |
| InChI | InChI=1S/C16H16N6O/c1-2-13-11(15(23)21-16(17)18)9-20-22(13)14-7-3-6-12-10(14)5-4-8-19-12/h3-9H,2H2,1H3,(H4,17,18,21,23) |
| InChIKey | DMPMGKQJJZZRCE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|