C19H24N6O7S2 — CID 172848595
5-cyclopropyl-N-(diaminomethylidene)-1-quinolin-5-ylpyrazole-4-carboxamide;methanesulfonic acid (PubChem CID 172848595) has the molecular formula C19H24N6O7S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is 5-cyclopropyl-N-(diaminomethylidene)-1-quinolin-5-ylpyrazole-4-carboxamide;methanesulfonic acid.
| Compound Name | 5-cyclopropyl-N-(diaminomethylidene)-1-quinolin-5-ylpyrazole-4-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 172848595 |
| Molecular Formula | C19H24N6O7S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 5-cyclopropyl-N-(diaminomethylidene)-1-quinolin-5-ylpyrazole-4-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.NC(N)=NC(=O)c1cnn(-c2cccc3ncccc23)c1C1CC1 |
| InChI | InChI=1S/C17H16N6O.2CH4O3S/c18-17(19)22-16(24)12-9-21-23(15(12)10-6-7-10)14-5-1-4-13-11(14)3-2-8-20-13;2*1-5(2,3)4/h1-5,8-10H,6-7H2,(H4,18,19,22,24);2*1H3,(H,2,3,4) |
| InChIKey | XTMAYRWESPHYTA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 220.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|