C22H20N6O2 — CID 22267867
N-(diaminomethylidene)-5-(phenylmethoxymethyl)-1-quinolin-5-ylpyrazole-4-carboxamide (PubChem CID 22267867) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-(phenylmethoxymethyl)-1-quinolin-5-ylpyrazole-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-5-(phenylmethoxymethyl)-1-quinolin-5-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 22267867 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(diaminomethylidene)-5-(phenylmethoxymethyl)-1-quinolin-5-ylpyrazole-4-carboxamide |
| SMILES | NC(N)=NC(=O)c1cnn(-c2cccc3ncccc23)c1COCc1ccccc1 |
| InChI | InChI=1S/C22H20N6O2/c23-22(24)27-21(29)17-12-26-28(19-10-4-9-18-16(19)8-5-11-25-18)20(17)14-30-13-15-6-2-1-3-7-15/h1-12H,13-14H2,(H4,23,24,27,29) |
| InChIKey | YYKLHFFCCXVJKT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|