C15H11F2N3O2 — CID 135132296
5-(1,1-difluoroethyl)-1-quinolin-5-ylpyrazole-4-carboxylic acid (PubChem CID 135132296) has the molecular formula C15H11F2N3O2 and a molecular weight of 303.27 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-1-quinolin-5-ylpyrazole-4-carboxylic acid.
| Compound Name | 5-(1,1-difluoroethyl)-1-quinolin-5-ylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135132296 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-(1,1-difluoroethyl)-1-quinolin-5-ylpyrazole-4-carboxylic acid |
| SMILES | CC(F)(F)c1c(C(=O)O)cnn1-c1cccc2ncccc12 |
| InChI | InChI=1S/C15H11F2N3O2/c1-15(16,17)13-10(14(21)22)8-19-20(13)12-6-2-5-11-9(12)4-3-7-18-11/h2-8H,1H3,(H,21,22) |
| InChIKey | BYRSUQYDPLXAQV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |