C21H13F3N6O2 — CID 140879746
N-(5-isocyano-6-methoxy-3-pyridinyl)-1-quinolin-5-yl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 140879746) has the molecular formula C21H13F3N6O2 and a molecular weight of 438.37 g/mol. Its IUPAC name is N-(5-isocyano-6-methoxy-3-pyridinyl)-1-quinolin-5-yl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(5-isocyano-6-methoxy-3-pyridinyl)-1-quinolin-5-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 140879746 |
| Molecular Formula | C21H13F3N6O2 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N-(5-isocyano-6-methoxy-3-pyridinyl)-1-quinolin-5-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2cnn(-c3cccc4ncccc34)c2C(F)(F)F)cnc1OC |
| InChI | InChI=1S/C21H13F3N6O2/c1-25-16-9-12(10-27-20(16)32-2)29-19(31)14-11-28-30(18(14)21(22,23)24)17-7-3-6-15-13(17)5-4-8-26-15/h3-11H,2H3,(H,29,31) |
| InChIKey | PMXYBFLYUHJQFN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|