C24H20F3N7O2 — CID 140879745
N-[6-(4-aminobutoxy)-5-isocyano-3-pyridinyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 140879745) has the molecular formula C24H20F3N7O2 and a molecular weight of 495.47 g/mol. Its IUPAC name is N-[6-(4-aminobutoxy)-5-isocyano-3-pyridinyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[6-(4-aminobutoxy)-5-isocyano-3-pyridinyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 140879745 |
| Molecular Formula | C24H20F3N7O2 |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[6-(4-aminobutoxy)-5-isocyano-3-pyridinyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2cnn(-c3cncc4ccccc34)c2C(F)(F)F)cnc1OCCCCN |
| InChI | InChI=1S/C24H20F3N7O2/c1-29-19-10-16(12-31-23(19)36-9-5-4-8-28)33-22(35)18-13-32-34(21(18)24(25,26)27)20-14-30-11-15-6-2-3-7-17(15)20/h2-3,6-7,10-14H,4-5,8-9,28H2,(H,33,35) |
| InChIKey | RMZOAYHNTLGXEX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|