C22H17ClF3N7O — CID 135169524
N-[4-[amino-[(Z)-2-aminoethenyl]amino]-3-chlorophenyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 135169524) has the molecular formula C22H17ClF3N7O and a molecular weight of 487.87 g/mol. Its IUPAC name is N-[4-[amino-[(Z)-2-aminoethenyl]amino]-3-chlorophenyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-[amino-[(Z)-2-aminoethenyl]amino]-3-chlorophenyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135169524 |
| Molecular Formula | C22H17ClF3N7O |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-[4-[amino-[(Z)-2-aminoethenyl]amino]-3-chlorophenyl]-1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | N/C=C\N(N)c1ccc(NC(=O)c2cnn(-c3cncc4ccccc34)c2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C22H17ClF3N7O/c23-17-9-14(5-6-18(17)32(28)8-7-27)31-21(34)16-11-30-33(20(16)22(24,25)26)19-12-29-10-13-3-1-2-4-15(13)19/h1-12H,27-28H2,(H,31,34)/b8-7- |
| InChIKey | DNNBYPSZNNGJEA-FPLPWBNLSA-N |
| XLogP | 4.45 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|