C17H7Cl5F3N3O — CID 134093988
N-(3,4-dichlorophenyl)-1-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 134093988) has the molecular formula C17H7Cl5F3N3O and a molecular weight of 503.52 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134093988 |
| Molecular Formula | C17H7Cl5F3N3O |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 500.90 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cnn(-c2cc(Cl)c(Cl)c(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C17H7Cl5F3N3O/c18-10-2-1-7(3-11(10)19)27-16(29)9-6-26-28(15(9)17(23,24)25)8-4-12(20)14(22)13(21)5-8/h1-6H,(H,27,29) |
| InChIKey | LWKXJOREDLGXQM-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|