C18H10BrF6N3O — CID 24665224
N-[4-bromo-3-(trifluoromethyl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 24665224) has the molecular formula C18H10BrF6N3O and a molecular weight of 478.19 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24665224 |
| Molecular Formula | C18H10BrF6N3O |
| Molecular Weight | 478.19 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(C(F)(F)F)c1)c1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C18H10BrF6N3O/c19-14-7-6-10(8-13(14)17(20,21)22)27-16(29)12-9-26-28(15(12)18(23,24)25)11-4-2-1-3-5-11/h1-9H,(H,27,29) |
| InChIKey | IFVGJHLBGZLGIO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.19 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |