C18H12BrF4N3O — CID 31784434
N-(4-bromo-3-methylphenyl)-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 31784434) has the molecular formula C18H12BrF4N3O and a molecular weight of 442.21 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31784434 |
| Molecular Formula | C18H12BrF4N3O |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnn(-c3ccc(F)cc3)c2C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C18H12BrF4N3O/c1-10-8-12(4-7-15(10)19)25-17(27)14-9-24-26(16(14)18(21,22)23)13-5-2-11(20)3-6-13/h2-9H,1H3,(H,25,27) |
| InChIKey | XTTPSSOYMAORNI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |