C12H8F3NO4 — CID 69438515
quinoline-5-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 69438515) has the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. Its IUPAC name is quinoline-5-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | quinoline-5-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69438515 |
| Molecular Formula | C12H8F3NO4 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | quinoline-5-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1cccc2ncccc12 |
| InChI | InChI=1S/C10H7NO2.C2HF3O2/c12-10(13)8-3-1-5-9-7(8)4-2-6-11-9;3-2(4,5)1(6)7/h1-6H,(H,12,13);(H,6,7) |
| InChIKey | OAVIPMHZTBISLW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |