C15H12N3O2- — CID 22267781
5-ethyl-1-quinolin-5-ylpyrazole-4-carboxylate (PubChem CID 22267781) has the molecular formula C15H12N3O2- and a molecular weight of 266.28 g/mol. Its IUPAC name is 5-ethyl-1-quinolin-5-ylpyrazole-4-carboxylate.
| Compound Name | 5-ethyl-1-quinolin-5-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 22267781 |
| Molecular Formula | C15H12N3O2- |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-ethyl-1-quinolin-5-ylpyrazole-4-carboxylate |
| SMILES | CCc1c(C(=O)[O-])cnn1-c1cccc2ncccc12 |
| InChI | InChI=1S/C15H13N3O2/c1-2-13-11(15(19)20)9-17-18(13)14-7-3-6-12-10(14)5-4-8-16-12/h3-9H,2H2,1H3,(H,19,20)/p-1 |
| InChIKey | NWYHYJVRSBVTGC-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |