C15H13ClF3N5O — CID 152504275
1-[3-chloro-2-(trifluoromethyl)phenyl]-5-cyclopropyl-N-(diaminomethylidene)pyrazole-4-carboxamide (PubChem CID 152504275) has the molecular formula C15H13ClF3N5O and a molecular weight of 371.75 g/mol. Its IUPAC name is 1-[3-chloro-2-(trifluoromethyl)phenyl]-5-cyclopropyl-N-(diaminomethylidene)pyrazole-4-carboxamide.
| Compound Name | 1-[3-chloro-2-(trifluoromethyl)phenyl]-5-cyclopropyl-N-(diaminomethylidene)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 152504275 |
| Molecular Formula | C15H13ClF3N5O |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 1-[3-chloro-2-(trifluoromethyl)phenyl]-5-cyclopropyl-N-(diaminomethylidene)pyrazole-4-carboxamide |
| SMILES | NC(N)=NC(=O)c1cnn(-c2cccc(Cl)c2C(F)(F)F)c1C1CC1 |
| InChI | InChI=1S/C15H13ClF3N5O/c16-9-2-1-3-10(11(9)15(17,18)19)24-12(7-4-5-7)8(6-22-24)13(25)23-14(20)21/h1-3,6-7H,4-5H2,(H4,20,21,23,25) |
| InChIKey | YECVLCSNLBYIJD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|