C12H11Cl2N5O — CID 22267735
N-(diaminomethylidene)-1-(3,5-dichlorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 22267735) has the molecular formula C12H11Cl2N5O and a molecular weight of 312.16 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-(3,5-dichlorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-(diaminomethylidene)-1-(3,5-dichlorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 22267735 |
| Molecular Formula | C12H11Cl2N5O |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-(diaminomethylidene)-1-(3,5-dichlorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N=C(N)N)cnn1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N5O/c1-6-10(11(20)18-12(15)16)5-17-19(6)9-3-7(13)2-8(14)4-9/h2-5H,1H3,(H4,15,16,18,20) |
| InChIKey | RTUPGTCNQTZUKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|