C16H10Cl3NOS — CID 173391309
2-(1,3-benzothiazol-2-yl)-1-[4-(trichloromethyl)phenyl]ethenol (PubChem CID 173391309) has the molecular formula C16H10Cl3NOS and a molecular weight of 370.69 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-[4-(trichloromethyl)phenyl]ethenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-[4-(trichloromethyl)phenyl]ethenol |
|---|---|
| PubChem CID | 173391309 |
| Molecular Formula | C16H10Cl3NOS |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-[4-(trichloromethyl)phenyl]ethenol |
| SMILES | OC(=Cc1nc2ccccc2s1)c1ccc(C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H10Cl3NOS/c17-16(18,19)11-7-5-10(6-8-11)13(21)9-15-20-12-3-1-2-4-14(12)22-15/h1-9,21H |
| InChIKey | HOILPOXNYHMLHR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|