C42H68N2O6S4Si2 — CID 57069957
[2-(1,3-benzothiazol-2-yl)-2-[[1-(1,3-benzothiazol-2-yl)-2-tri(butan-2-yloxy)silylethyl]disulfanyl]ethyl]-tri(butan-2-yloxy)silane (PubChem CID 57069957) has the molecular formula C42H68N2O6S4Si2 and a molecular weight of 881.45 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-2-[[1-(1,3-benzothiazol-2-yl)-2-tri(butan-2-yloxy)silylethyl]disulfanyl]ethyl]-tri(butan-2-yloxy)silane.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-2-[[1-(1,3-benzothiazol-2-yl)-2-tri(butan-2-yloxy)silylethyl]disulfanyl]ethyl]-tri(butan-2-yloxy)silane |
|---|---|
| PubChem CID | 57069957 |
| Molecular Formula | C42H68N2O6S4Si2 |
| Molecular Weight | 881.45 g/mol |
| Exact Mass | 880.35 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-2-[[1-(1,3-benzothiazol-2-yl)-2-tri(butan-2-yloxy)silylethyl]disulfanyl]ethyl]-tri(butan-2-yloxy)silane |
| SMILES | CCC(C)O[Si](CC(SSC(C[Si](OC(C)CC)(OC(C)CC)OC(C)CC)c1nc2ccccc2s1)c1nc2ccccc2s1)(OC(C)CC)OC(C)CC |
| InChI | InChI=1S/C42H68N2O6S4Si2/c1-13-29(7)45-55(46-30(8)14-2,47-31(9)15-3)27-39(41-43-35-23-19-21-25-37(35)51-41)53-54-40(42-44-36-24-20-22-26-38(36)52-42)28-56(48-32(10)16-4,49-33(11)17-5)50-34(12)18-6/h19-26,29-34,39-40H,13-18,27-28H2,1-12H3 |
| InChIKey | FVZNTOCETNXKQI-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.45 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|