C16H22N4O5S3 — CID 16576018
dimethyl 5-amino-3-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2,4-dicarboxylate (PubChem CID 16576018) has the molecular formula C16H22N4O5S3 and a molecular weight of 446.58 g/mol. Its IUPAC name is dimethyl 5-amino-3-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16576018 |
| Molecular Formula | C16H22N4O5S3 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | dimethyl 5-amino-3-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2,4-dicarboxylate |
| SMILES | CCOCCCNc1nnc(SCc2c(C(=O)OC)sc(N)c2C(=O)OC)s1 |
| InChI | InChI=1S/C16H22N4O5S3/c1-4-25-7-5-6-18-15-19-20-16(28-15)26-8-9-10(13(21)23-2)12(17)27-11(9)14(22)24-3/h4-8,17H2,1-3H3,(H,18,19) |
| InChIKey | NXAZLURDGHSGKJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|