C14H15FN2O2S — CID 103425708
methyl 3-amino-5-[2-(2-fluorophenyl)ethylamino]thiophene-2-carboxylate (PubChem CID 103425708) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 3-amino-5-[2-(2-fluorophenyl)ethylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-[2-(2-fluorophenyl)ethylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103425708 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | methyl 3-amino-5-[2-(2-fluorophenyl)ethylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NCCc2ccccc2F)cc1N |
| InChI | InChI=1S/C14H15FN2O2S/c1-19-14(18)13-11(16)8-12(20-13)17-7-6-9-4-2-3-5-10(9)15/h2-5,8,17H,6-7,16H2,1H3 |
| InChIKey | BJDGLBCXFJBJNS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |