C8H12N2O2S — CID 103424518
methyl 3-amino-5-(ethylamino)thiophene-2-carboxylate (PubChem CID 103424518) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl 3-amino-5-(ethylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-(ethylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103424518 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | methyl 3-amino-5-(ethylamino)thiophene-2-carboxylate |
| SMILES | CCNc1cc(N)c(C(=O)OC)s1 |
| InChI | InChI=1S/C8H12N2O2S/c1-3-10-6-4-5(9)7(13-6)8(11)12-2/h4,10H,3,9H2,1-2H3 |
| InChIKey | PVEXOOKLZDYRJS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |