C17H17ClN2O6S — CID 8510950
dimethyl 5-amino-3-[(2-chloro-4,6-dimethylpyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 8510950) has the molecular formula C17H17ClN2O6S and a molecular weight of 412.85 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(2-chloro-4,6-dimethylpyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[(2-chloro-4,6-dimethylpyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 8510950 |
| Molecular Formula | C17H17ClN2O6S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | dimethyl 5-amino-3-[(2-chloro-4,6-dimethylpyridine-3-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)c1c(C)cc(C)nc1Cl |
| InChI | InChI=1S/C17H17ClN2O6S/c1-7-5-8(2)20-13(18)10(7)16(22)26-6-9-11(15(21)24-3)14(19)27-12(9)17(23)25-4/h5H,6,19H2,1-4H3 |
| InChIKey | ZWCONRHTFWHPBD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|