C19H22N2O8S — CID 30208469
2-O-[[5-amino-2,4-bis(methoxycarbonyl)thiophen-3-yl]methyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 30208469) has the molecular formula C19H22N2O8S and a molecular weight of 438.46 g/mol. Its IUPAC name is 2-O-[[5-amino-2,4-bis(methoxycarbonyl)thiophen-3-yl]methyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-[[5-amino-2,4-bis(methoxycarbonyl)thiophen-3-yl]methyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 30208469 |
| Molecular Formula | C19H22N2O8S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-O-[[5-amino-2,4-bis(methoxycarbonyl)thiophen-3-yl]methyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCc1[nH]c(C(=O)OCc2c(C(=O)OC)sc(N)c2C(=O)OC)c(C)c1C(=O)OC |
| InChI | InChI=1S/C19H22N2O8S/c1-6-10-11(16(22)26-3)8(2)13(21-10)18(24)29-7-9-12(17(23)27-4)15(20)30-14(9)19(25)28-5/h21H,6-7,20H2,1-5H3 |
| InChIKey | JDEDGZNTHYDSCY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|