C18H22N2O5 — CID 8847975
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2-methoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 8847975) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2-methoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2-methoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8847975 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-2-[(2-methoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@@H](NC(=O)c1ccccc1OC)C(C)C |
| InChI | InChI=1S/C18H22N2O5/c1-5-10-19-15(21)11-25-18(23)16(12(2)3)20-17(22)13-8-6-7-9-14(13)24-4/h1,6-9,12,16H,10-11H2,2-4H3,(H,19,21)(H,20,22)/t16-/m0/s1 |
| InChIKey | XXGQTZHJUQFYQF-INIZCTEOSA-N |
| XLogP | 0.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|